C22H32N2O4 — CID 19912004
N-[5-(3-ethyloctan-3-yl)-1,2-oxazol-3-yl]-2,6-dimethoxybenzamide (PubChem CID 19912004) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is N-[5-(3-ethyloctan-3-yl)-1,2-oxazol-3-yl]-2,6-dimethoxybenzamide.
| Compound Name | N-[5-(3-ethyloctan-3-yl)-1,2-oxazol-3-yl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 19912004 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | N-[5-(3-ethyloctan-3-yl)-1,2-oxazol-3-yl]-2,6-dimethoxybenzamide |
| SMILES | CCCCCC(CC)(CC)c1cc(NC(=O)c2c(OC)cccc2OC)no1 |
| InChI | InChI=1S/C22H32N2O4/c1-6-9-10-14-22(7-2,8-3)18-15-19(24-28-18)23-21(25)20-16(26-4)12-11-13-17(20)27-5/h11-13,15H,6-10,14H2,1-5H3,(H,23,24,25) |
| InChIKey | ZZOCVBDQBVJHSQ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|