C20H28N2O3S — CID 19912027
2,6-dimethoxy-N-[5-(3-methylheptan-3-yl)-1,2-oxazol-3-yl]benzenecarbothioamide (PubChem CID 19912027) has the molecular formula C20H28N2O3S and a molecular weight of 376.52 g/mol. Its IUPAC name is 2,6-dimethoxy-N-[5-(3-methylheptan-3-yl)-1,2-oxazol-3-yl]benzenecarbothioamide.
| Compound Name | 2,6-dimethoxy-N-[5-(3-methylheptan-3-yl)-1,2-oxazol-3-yl]benzenecarbothioamide |
|---|---|
| PubChem CID | 19912027 |
| Molecular Formula | C20H28N2O3S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 2,6-dimethoxy-N-[5-(3-methylheptan-3-yl)-1,2-oxazol-3-yl]benzenecarbothioamide |
| SMILES | CCCCC(C)(CC)c1cc(NC(=S)c2c(OC)cccc2OC)no1 |
| InChI | InChI=1S/C20H28N2O3S/c1-6-8-12-20(3,7-2)16-13-17(22-25-16)21-19(26)18-14(23-4)10-9-11-15(18)24-5/h9-11,13H,6-8,12H2,1-5H3,(H,21,22,26) |
| InChIKey | RJUKJCMRLVYKJF-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 56.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|