C12H14ClNO4 — CID 169451677
2-[(2-chloro-3,4-dihydroxyphenyl)methyl]-4,4-dimethyl-1,2-oxazolidin-3-one (PubChem CID 169451677) has the molecular formula C12H14ClNO4 and a molecular weight of 271.70 g/mol. Its IUPAC name is 2-[(2-chloro-3,4-dihydroxyphenyl)methyl]-4,4-dimethyl-1,2-oxazolidin-3-one.
| Compound Name | 2-[(2-chloro-3,4-dihydroxyphenyl)methyl]-4,4-dimethyl-1,2-oxazolidin-3-one |
|---|---|
| PubChem CID | 169451677 |
| Molecular Formula | C12H14ClNO4 |
| Molecular Weight | 271.70 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 2-[(2-chloro-3,4-dihydroxyphenyl)methyl]-4,4-dimethyl-1,2-oxazolidin-3-one |
| SMILES | CC1(C)CON(Cc2ccc(O)c(O)c2Cl)C1=O |
| InChI | InChI=1S/C12H14ClNO4/c1-12(2)6-18-14(11(12)17)5-7-3-4-8(15)10(16)9(7)13/h3-4,15-16H,5-6H2,1-2H3 |
| InChIKey | AKVJDFHPOUPLPM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.70 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|