About 3-(1H-pyrrolo[2,3-b]pyridin-5-yl)prop-2-en-1-ol
3-(1H-pyrrolo[2,3-b]pyridin-5-yl)prop-2-en-1-ol (PubChem CID 169453432) has the molecular formula C10H10N2O
and a molecular weight of 174.20 g/mol. Its IUPAC name is 3-(1H-pyrrolo[2,3-b]pyridin-5-yl)prop-2-en-1-ol.
Molecular Properties
| Compound Name | 3-(1H-pyrrolo[2,3-b]pyridin-5-yl)prop-2-en-1-ol |
| PubChem CID | 169453432 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 3-(1H-pyrrolo[2,3-b]pyridin-5-yl)prop-2-en-1-ol |
| SMILES | OCC=Cc1cnc2[nH]ccc2c1 |
| InChI | InChI=1S/C10H10N2O/c13-5-1-2-8-6-9-3-4-11-10(9)12-7-8/h1-4,6-7,13H,5H2,(H,11,12) |
| InChIKey | DTDXTUCQJUXVTE-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(1H-pyrrolo[2,3-b]pyridin-5-yl)prop-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1H-pyrrolo[2,3-b]pyridin-5-yl)prop-2-en-1-ol?
The IUPAC name of 3-(1H-pyrrolo[2,3-b]pyridin-5-yl)prop-2-en-1-ol (CID 169453432) is 3-(1H-pyrrolo[2,3-b]pyridin-5-yl)prop-2-en-1-ol.
What is the SMILES notation for 3-(1H-pyrrolo[2,3-b]pyridin-5-yl)prop-2-en-1-ol?
The canonical SMILES for 3-(1H-pyrrolo[2,3-b]pyridin-5-yl)prop-2-en-1-ol is OCC=Cc1cnc2[nH]ccc2c1.
What is the InChIKey of 3-(1H-pyrrolo[2,3-b]pyridin-5-yl)prop-2-en-1-ol?
The InChIKey is DTDXTUCQJUXVTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O/c13-5-1-2-8-6-9-3-4-11-10(9)12-7-8/h1-4,6-7,13H,5H2,(H,11,12).
What are the key properties of 3-(1H-pyrrolo[2,3-b]pyridin-5-yl)prop-2-en-1-ol?
3-(1H-pyrrolo[2,3-b]pyridin-5-yl)prop-2-en-1-ol has a molecular weight of 174.20 g/mol, XLogP of 1.57, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1H-pyrrolo[2,3-b]pyridin-5-yl)prop-2-en-1-ol is sourced from PubChem (CID 169453432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).