C25H23N3O4S — CID 16945907
N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-1,3-benzodioxole-5-carboxamide (PubChem CID 16945907) has the molecular formula C25H23N3O4S and a molecular weight of 461.54 g/mol. Its IUPAC name is N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 16945907 |
| Molecular Formula | C25H23N3O4S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(Nc1nc2c(s1)CCCC2C(=O)N1CCCc2ccccc21)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H23N3O4S/c29-23(16-10-11-19-20(13-16)32-14-31-19)27-25-26-22-17(7-3-9-21(22)33-25)24(30)28-12-4-6-15-5-1-2-8-18(15)28/h1-2,5,8,10-11,13,17H,3-4,6-7,9,12,14H2,(H,26,27,29) |
| InChIKey | JPHFAZNKPYMSQL-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |