C11H9N3O3 — CID 169462417
6-(3-azidoprop-1-enyl)-1,3-benzodioxole-5-carbaldehyde (PubChem CID 169462417) has the molecular formula C11H9N3O3 and a molecular weight of 231.21 g/mol. Its IUPAC name is 6-(3-azidoprop-1-enyl)-1,3-benzodioxole-5-carbaldehyde.
| Compound Name | 6-(3-azidoprop-1-enyl)-1,3-benzodioxole-5-carbaldehyde |
|---|---|
| PubChem CID | 169462417 |
| Molecular Formula | C11H9N3O3 |
| Molecular Weight | 231.21 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 6-(3-azidoprop-1-enyl)-1,3-benzodioxole-5-carbaldehyde |
| SMILES | [N-]=[N+]=NCC=Cc1cc2c(cc1C=O)OCO2 |
| InChI | InChI=1S/C11H9N3O3/c12-14-13-3-1-2-8-4-10-11(17-7-16-10)5-9(8)6-15/h1-2,4-6H,3,7H2 |
| InChIKey | WPKHRZNUGLFQHZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 84.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.21 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|