C15H13N3 — CID 169462599
5-(3-azidoprop-1-enyl)-1,2-dihydroacenaphthylene (PubChem CID 169462599) has the molecular formula C15H13N3 and a molecular weight of 235.29 g/mol. Its IUPAC name is 5-(3-azidoprop-1-enyl)-1,2-dihydroacenaphthylene.
| Compound Name | 5-(3-azidoprop-1-enyl)-1,2-dihydroacenaphthylene |
|---|---|
| PubChem CID | 169462599 |
| Molecular Formula | C15H13N3 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 5-(3-azidoprop-1-enyl)-1,2-dihydroacenaphthylene |
| SMILES | [N-]=[N+]=NCC=Cc1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C15H13N3/c16-18-17-10-2-4-11-6-7-13-9-8-12-3-1-5-14(11)15(12)13/h1-7H,8-10H2 |
| InChIKey | GEEIIZVNYQIPNG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|