C15H13Br — CID 169476332
5-(3-bromoprop-1-enyl)-1,2-dihydroacenaphthylene (PubChem CID 169476332) has the molecular formula C15H13Br and a molecular weight of 273.17 g/mol. Its IUPAC name is 5-(3-bromoprop-1-enyl)-1,2-dihydroacenaphthylene.
| Compound Name | 5-(3-bromoprop-1-enyl)-1,2-dihydroacenaphthylene |
|---|---|
| PubChem CID | 169476332 |
| Molecular Formula | C15H13Br |
| Molecular Weight | 273.17 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | 5-(3-bromoprop-1-enyl)-1,2-dihydroacenaphthylene |
| SMILES | BrCC=Cc1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C15H13Br/c16-10-2-4-11-6-7-13-9-8-12-3-1-5-14(11)15(12)13/h1-7H,8-10H2 |
| InChIKey | CNTKWIBMKNXFDA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.17 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|