C11H12FNO2 — CID 169464007
2-[5-(3-aminoprop-1-enyl)-2-fluorophenyl]acetic acid (PubChem CID 169464007) has the molecular formula C11H12FNO2 and a molecular weight of 209.22 g/mol. Its IUPAC name is 2-[5-(3-aminoprop-1-enyl)-2-fluorophenyl]acetic acid.
| Compound Name | 2-[5-(3-aminoprop-1-enyl)-2-fluorophenyl]acetic acid |
|---|---|
| PubChem CID | 169464007 |
| Molecular Formula | C11H12FNO2 |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 2-[5-(3-aminoprop-1-enyl)-2-fluorophenyl]acetic acid |
| SMILES | NCC=Cc1ccc(F)c(CC(=O)O)c1 |
| InChI | InChI=1S/C11H12FNO2/c12-10-4-3-8(2-1-5-13)6-9(10)7-11(14)15/h1-4,6H,5,7,13H2,(H,14,15) |
| InChIKey | LAQVMOMLCHOYQR-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |