C20H20FNO4 — CID 170494554
2-[2-fluoro-5-[4-(phenylmethoxycarbonylamino)but-1-enyl]phenyl]acetic acid (PubChem CID 170494554) has the molecular formula C20H20FNO4 and a molecular weight of 357.38 g/mol. Its IUPAC name is 2-[2-fluoro-5-[4-(phenylmethoxycarbonylamino)but-1-enyl]phenyl]acetic acid.
| Compound Name | 2-[2-fluoro-5-[4-(phenylmethoxycarbonylamino)but-1-enyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 170494554 |
| Molecular Formula | C20H20FNO4 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 2-[2-fluoro-5-[4-(phenylmethoxycarbonylamino)but-1-enyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1cc(C=CCCNC(=O)OCc2ccccc2)ccc1F |
| InChI | InChI=1S/C20H20FNO4/c21-18-10-9-15(12-17(18)13-19(23)24)6-4-5-11-22-20(25)26-14-16-7-2-1-3-8-16/h1-4,6-10,12H,5,11,13-14H2,(H,22,25)(H,23,24) |
| InChIKey | FOYKCYTXCQHDOK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|