About N-[3-(3,5-dimethyl-1H-pyrrol-2-yl)prop-2-enyl]acetamide
N-[3-(3,5-dimethyl-1H-pyrrol-2-yl)prop-2-enyl]acetamide (PubChem CID 169466762) has the molecular formula C11H16N2O
and a molecular weight of 192.26 g/mol. Its IUPAC name is N-[3-(3,5-dimethyl-1H-pyrrol-2-yl)prop-2-enyl]acetamide.
Molecular Properties
| Compound Name | N-[3-(3,5-dimethyl-1H-pyrrol-2-yl)prop-2-enyl]acetamide |
| PubChem CID | 169466762 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | N-[3-(3,5-dimethyl-1H-pyrrol-2-yl)prop-2-enyl]acetamide |
| SMILES | CC(=O)NCC=Cc1[nH]c(C)cc1C |
| InChI | InChI=1S/C11H16N2O/c1-8-7-9(2)13-11(8)5-4-6-12-10(3)14/h4-5,7,13H,6H2,1-3H3,(H,12,14) |
| InChIKey | LITQHVWSKANMQV-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[3-(3,5-dimethyl-1H-pyrrol-2-yl)prop-2-enyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(3,5-dimethyl-1H-pyrrol-2-yl)prop-2-enyl]acetamide?
The IUPAC name of N-[3-(3,5-dimethyl-1H-pyrrol-2-yl)prop-2-enyl]acetamide (CID 169466762) is N-[3-(3,5-dimethyl-1H-pyrrol-2-yl)prop-2-enyl]acetamide.
What is the SMILES notation for N-[3-(3,5-dimethyl-1H-pyrrol-2-yl)prop-2-enyl]acetamide?
The canonical SMILES for N-[3-(3,5-dimethyl-1H-pyrrol-2-yl)prop-2-enyl]acetamide is CC(=O)NCC=Cc1[nH]c(C)cc1C.
What is the InChIKey of N-[3-(3,5-dimethyl-1H-pyrrol-2-yl)prop-2-enyl]acetamide?
The InChIKey is LITQHVWSKANMQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O/c1-8-7-9(2)13-11(8)5-4-6-12-10(3)14/h4-5,7,13H,6H2,1-3H3,(H,12,14).
What are the key properties of N-[3-(3,5-dimethyl-1H-pyrrol-2-yl)prop-2-enyl]acetamide?
N-[3-(3,5-dimethyl-1H-pyrrol-2-yl)prop-2-enyl]acetamide has a molecular weight of 192.26 g/mol, XLogP of 1.78, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(3,5-dimethyl-1H-pyrrol-2-yl)prop-2-enyl]acetamide is sourced from PubChem (CID 169466762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).