C15H20FNO3 — CID 169468695
tert-butyl N-[3-(5-fluoro-2-hydroxy-3-methylphenyl)prop-2-enyl]carbamate (PubChem CID 169468695) has the molecular formula C15H20FNO3 and a molecular weight of 281.33 g/mol. Its IUPAC name is tert-butyl N-[3-(5-fluoro-2-hydroxy-3-methylphenyl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(5-fluoro-2-hydroxy-3-methylphenyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169468695 |
| Molecular Formula | C15H20FNO3 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | tert-butyl N-[3-(5-fluoro-2-hydroxy-3-methylphenyl)prop-2-enyl]carbamate |
| SMILES | Cc1cc(F)cc(C=CCNC(=O)OC(C)(C)C)c1O |
| InChI | InChI=1S/C15H20FNO3/c1-10-8-12(16)9-11(13(10)18)6-5-7-17-14(19)20-15(2,3)4/h5-6,8-9,18H,7H2,1-4H3,(H,17,19) |
| InChIKey | FFXOJKRAHGTSKP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |