C24H22N2O2 — CID 169469022
9H-fluoren-9-ylmethyl N-[3-(2-methyl-4-pyridinyl)prop-2-enyl]carbamate (PubChem CID 169469022) has the molecular formula C24H22N2O2 and a molecular weight of 370.45 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(2-methyl-4-pyridinyl)prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(2-methyl-4-pyridinyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169469022 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(2-methyl-4-pyridinyl)prop-2-enyl]carbamate |
| SMILES | Cc1cc(C=CCNC(=O)OCC2c3ccccc3-c3ccccc32)ccn1 |
| InChI | InChI=1S/C24H22N2O2/c1-17-15-18(12-14-25-17)7-6-13-26-24(27)28-16-23-21-10-4-2-8-19(21)20-9-3-5-11-22(20)23/h2-12,14-15,23H,13,16H2,1H3,(H,26,27) |
| InChIKey | CUHHFWIALJMIDL-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |