C24H19F3N2O2 — CID 169469934
9H-fluoren-9-ylmethyl N-[3-[4-(trifluoromethyl)-2-pyridinyl]prop-2-enyl]carbamate (PubChem CID 169469934) has the molecular formula C24H19F3N2O2 and a molecular weight of 424.42 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-[4-(trifluoromethyl)-2-pyridinyl]prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-[4-(trifluoromethyl)-2-pyridinyl]prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169469934 |
| Molecular Formula | C24H19F3N2O2 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-[4-(trifluoromethyl)-2-pyridinyl]prop-2-enyl]carbamate |
| SMILES | O=C(NCC=Cc1cc(C(F)(F)F)ccn1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H19F3N2O2/c25-24(26,27)16-11-13-28-17(14-16)6-5-12-29-23(30)31-15-22-20-9-3-1-7-18(20)19-8-2-4-10-21(19)22/h1-11,13-14,22H,12,15H2,(H,29,30) |
| InChIKey | ZWOSZNLIXXBZAT-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |