C25H19F4NO2 — CID 169470062
9H-fluoren-9-ylmethyl N-[3-[3-fluoro-2-(trifluoromethyl)phenyl]prop-2-enyl]carbamate (PubChem CID 169470062) has the molecular formula C25H19F4NO2 and a molecular weight of 441.42 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-[3-fluoro-2-(trifluoromethyl)phenyl]prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-[3-fluoro-2-(trifluoromethyl)phenyl]prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169470062 |
| Molecular Formula | C25H19F4NO2 |
| Molecular Weight | 441.42 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-[3-fluoro-2-(trifluoromethyl)phenyl]prop-2-enyl]carbamate |
| SMILES | O=C(NCC=Cc1cccc(F)c1C(F)(F)F)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H19F4NO2/c26-22-13-5-7-16(23(22)25(27,28)29)8-6-14-30-24(31)32-15-21-19-11-3-1-9-17(19)18-10-2-4-12-20(18)21/h1-13,21H,14-15H2,(H,30,31) |
| InChIKey | BVZVKCISLZJXON-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.42 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |