C26H26N4O2 — CID 169470328
9H-fluoren-9-ylmethyl N-[3-(2-pyrrolidin-1-ylpyrimidin-5-yl)prop-2-enyl]carbamate (PubChem CID 169470328) has the molecular formula C26H26N4O2 and a molecular weight of 426.52 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(2-pyrrolidin-1-ylpyrimidin-5-yl)prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(2-pyrrolidin-1-ylpyrimidin-5-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169470328 |
| Molecular Formula | C26H26N4O2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(2-pyrrolidin-1-ylpyrimidin-5-yl)prop-2-enyl]carbamate |
| SMILES | O=C(NCC=Cc1cnc(N2CCCC2)nc1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H26N4O2/c31-26(27-13-7-8-19-16-28-25(29-17-19)30-14-5-6-15-30)32-18-24-22-11-3-1-9-20(22)21-10-2-4-12-23(21)24/h1-4,7-12,16-17,24H,5-6,13-15,18H2,(H,27,31) |
| InChIKey | VFYZONMVJMOUBR-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |