C27H25NO5 — CID 169470427
methyl 2-[4-[3-(9H-fluoren-9-ylmethoxycarbonylamino)prop-1-enyl]phenoxy]acetate (PubChem CID 169470427) has the molecular formula C27H25NO5 and a molecular weight of 443.50 g/mol. Its IUPAC name is methyl 2-[4-[3-(9H-fluoren-9-ylmethoxycarbonylamino)prop-1-enyl]phenoxy]acetate.
| Compound Name | methyl 2-[4-[3-(9H-fluoren-9-ylmethoxycarbonylamino)prop-1-enyl]phenoxy]acetate |
|---|---|
| PubChem CID | 169470427 |
| Molecular Formula | C27H25NO5 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | methyl 2-[4-[3-(9H-fluoren-9-ylmethoxycarbonylamino)prop-1-enyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(C=CCNC(=O)OCC2c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C27H25NO5/c1-31-26(29)18-32-20-14-12-19(13-15-20)7-6-16-28-27(30)33-17-25-23-10-4-2-8-21(23)22-9-3-5-11-24(22)25/h2-15,25H,16-18H2,1H3,(H,28,30) |
| InChIKey | AWBYPRPQPFSMQH-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |