C29H30N2O3 — CID 169470517
9H-fluoren-9-ylmethyl N-[3-[4-(4-hydroxypiperidin-4-yl)phenyl]prop-2-enyl]carbamate (PubChem CID 169470517) has the molecular formula C29H30N2O3 and a molecular weight of 454.57 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-[4-(4-hydroxypiperidin-4-yl)phenyl]prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-[4-(4-hydroxypiperidin-4-yl)phenyl]prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169470517 |
| Molecular Formula | C29H30N2O3 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-[4-(4-hydroxypiperidin-4-yl)phenyl]prop-2-enyl]carbamate |
| SMILES | O=C(NCC=Cc1ccc(C2(O)CCNCC2)cc1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C29H30N2O3/c32-28(34-20-27-25-9-3-1-7-23(25)24-8-2-4-10-26(24)27)31-17-5-6-21-11-13-22(14-12-21)29(33)15-18-30-19-16-29/h1-14,27,30,33H,15-20H2,(H,31,32) |
| InChIKey | YEECROCMKQKZJT-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |