C26H21NO2S2 — CID 169470883
9H-fluoren-9-ylmethyl N-[3-(5-thiophen-2-ylthiophen-2-yl)prop-2-enyl]carbamate (PubChem CID 169470883) has the molecular formula C26H21NO2S2 and a molecular weight of 443.59 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(5-thiophen-2-ylthiophen-2-yl)prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(5-thiophen-2-ylthiophen-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169470883 |
| Molecular Formula | C26H21NO2S2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(5-thiophen-2-ylthiophen-2-yl)prop-2-enyl]carbamate |
| SMILES | O=C(NCC=Cc1ccc(-c2cccs2)s1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H21NO2S2/c28-26(27-15-5-7-18-13-14-25(31-18)24-12-6-16-30-24)29-17-23-21-10-3-1-8-19(21)20-9-2-4-11-22(20)23/h1-14,16,23H,15,17H2,(H,27,28) |
| InChIKey | WOHUIXXSDGJNDM-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |