C18H16F3NO2S — CID 169472113
benzyl N-[3-[3-(trifluoromethylsulfanyl)phenyl]prop-2-enyl]carbamate (PubChem CID 169472113) has the molecular formula C18H16F3NO2S and a molecular weight of 367.39 g/mol. Its IUPAC name is benzyl N-[3-[3-(trifluoromethylsulfanyl)phenyl]prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-[3-(trifluoromethylsulfanyl)phenyl]prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169472113 |
| Molecular Formula | C18H16F3NO2S |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | benzyl N-[3-[3-(trifluoromethylsulfanyl)phenyl]prop-2-enyl]carbamate |
| SMILES | O=C(NCC=Cc1cccc(SC(F)(F)F)c1)OCc1ccccc1 |
| InChI | InChI=1S/C18H16F3NO2S/c19-18(20,21)25-16-10-4-8-14(12-16)9-5-11-22-17(23)24-13-15-6-2-1-3-7-15/h1-10,12H,11,13H2,(H,22,23) |
| InChIKey | DJICVJGLWGVPQB-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |