C19H16F3NO5 — CID 169472586
3-[3-(phenylmethoxycarbonylamino)prop-1-enyl]-5-(trifluoromethoxy)benzoic acid (PubChem CID 169472586) has the molecular formula C19H16F3NO5 and a molecular weight of 395.33 g/mol. Its IUPAC name is 3-[3-(phenylmethoxycarbonylamino)prop-1-enyl]-5-(trifluoromethoxy)benzoic acid.
| Compound Name | 3-[3-(phenylmethoxycarbonylamino)prop-1-enyl]-5-(trifluoromethoxy)benzoic acid |
|---|---|
| PubChem CID | 169472586 |
| Molecular Formula | C19H16F3NO5 |
| Molecular Weight | 395.33 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 3-[3-(phenylmethoxycarbonylamino)prop-1-enyl]-5-(trifluoromethoxy)benzoic acid |
| SMILES | O=C(NCC=Cc1cc(OC(F)(F)F)cc(C(=O)O)c1)OCc1ccccc1 |
| InChI | InChI=1S/C19H16F3NO5/c20-19(21,22)28-16-10-14(9-15(11-16)17(24)25)7-4-8-23-18(26)27-12-13-5-2-1-3-6-13/h1-7,9-11H,8,12H2,(H,23,26)(H,24,25) |
| InChIKey | UWKNSPPGNXNMLT-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.33 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |