C23H22FN3O2S — CID 16947230
2-[(4-fluorobenzoyl)amino]-N-(3-phenylpropyl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-4-carboxamide (PubChem CID 16947230) has the molecular formula C23H22FN3O2S and a molecular weight of 423.51 g/mol. Its IUPAC name is 2-[(4-fluorobenzoyl)amino]-N-(3-phenylpropyl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-4-carboxamide.
| Compound Name | 2-[(4-fluorobenzoyl)amino]-N-(3-phenylpropyl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-4-carboxamide |
|---|---|
| PubChem CID | 16947230 |
| Molecular Formula | C23H22FN3O2S |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 2-[(4-fluorobenzoyl)amino]-N-(3-phenylpropyl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-4-carboxamide |
| SMILES | O=C(Nc1nc2c(s1)CCC2C(=O)NCCCc1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H22FN3O2S/c24-17-10-8-16(9-11-17)21(28)27-23-26-20-18(12-13-19(20)30-23)22(29)25-14-4-7-15-5-2-1-3-6-15/h1-3,5-6,8-11,18H,4,7,12-14H2,(H,25,29)(H,26,27,28) |
| InChIKey | CAMFIDGOZZUDIN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|