C22H28FN3O2S — CID 16947305
2-[(4-fluorobenzoyl)amino]-N-octyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-4-carboxamide (PubChem CID 16947305) has the molecular formula C22H28FN3O2S and a molecular weight of 417.55 g/mol. Its IUPAC name is 2-[(4-fluorobenzoyl)amino]-N-octyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-4-carboxamide.
| Compound Name | 2-[(4-fluorobenzoyl)amino]-N-octyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-4-carboxamide |
|---|---|
| PubChem CID | 16947305 |
| Molecular Formula | C22H28FN3O2S |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 2-[(4-fluorobenzoyl)amino]-N-octyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-4-carboxamide |
| SMILES | CCCCCCCCNC(=O)C1CCc2sc(NC(=O)c3ccc(F)cc3)nc21 |
| InChI | InChI=1S/C22H28FN3O2S/c1-2-3-4-5-6-7-14-24-21(28)17-12-13-18-19(17)25-22(29-18)26-20(27)15-8-10-16(23)11-9-15/h8-11,17H,2-7,12-14H2,1H3,(H,24,28)(H,25,26,27) |
| InChIKey | ULCJKFHFJUNKBD-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|