C19H17N3O3 — CID 169472347
benzyl N-[3-(3-formyl-1H-pyrrolo[2,3-b]pyridin-5-yl)prop-2-enyl]carbamate (PubChem CID 169472347) has the molecular formula C19H17N3O3 and a molecular weight of 335.36 g/mol. Its IUPAC name is benzyl N-[3-(3-formyl-1H-pyrrolo[2,3-b]pyridin-5-yl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-(3-formyl-1H-pyrrolo[2,3-b]pyridin-5-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169472347 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | benzyl N-[3-(3-formyl-1H-pyrrolo[2,3-b]pyridin-5-yl)prop-2-enyl]carbamate |
| SMILES | O=Cc1c[nH]c2ncc(C=CCNC(=O)OCc3ccccc3)cc12 |
| InChI | InChI=1S/C19H17N3O3/c23-12-16-11-22-18-17(16)9-15(10-21-18)7-4-8-20-19(24)25-13-14-5-2-1-3-6-14/h1-7,9-12H,8,13H2,(H,20,24)(H,21,22) |
| InChIKey | WJWNAHOGFLOYNG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|