C12H12N2O2 — CID 169474313
6-[3-(methylamino)prop-1-enyl]-1H-indole-2,3-dione (PubChem CID 169474313) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is 6-[3-(methylamino)prop-1-enyl]-1H-indole-2,3-dione.
| Compound Name | 6-[3-(methylamino)prop-1-enyl]-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 169474313 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 6-[3-(methylamino)prop-1-enyl]-1H-indole-2,3-dione |
| SMILES | CNCC=Cc1ccc2c(c1)NC(=O)C2=O |
| InChI | InChI=1S/C12H12N2O2/c1-13-6-2-3-8-4-5-9-10(7-8)14-12(16)11(9)15/h2-5,7,13H,6H2,1H3,(H,14,15,16) |
| InChIKey | DBMZVPDGNMQJEM-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|