C11H14BrN — CID 169475520
4-(3-bromoprop-1-enyl)-2,3-dimethylaniline (PubChem CID 169475520) has the molecular formula C11H14BrN and a molecular weight of 240.14 g/mol. Its IUPAC name is 4-(3-bromoprop-1-enyl)-2,3-dimethylaniline.
| Compound Name | 4-(3-bromoprop-1-enyl)-2,3-dimethylaniline |
|---|---|
| PubChem CID | 169475520 |
| Molecular Formula | C11H14BrN |
| Molecular Weight | 240.14 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 4-(3-bromoprop-1-enyl)-2,3-dimethylaniline |
| SMILES | Cc1c(N)ccc(C=CCBr)c1C |
| InChI | InChI=1S/C11H14BrN/c1-8-9(2)11(13)6-5-10(8)4-3-7-12/h3-6H,7,13H2,1-2H3 |
| InChIKey | LLICAANOZWSRDA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.14 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|