C8H10ClN3 — CID 169477134
5-(3-chloroprop-1-enyl)pyridine-2,3-diamine (PubChem CID 169477134) has the molecular formula C8H10ClN3 and a molecular weight of 183.64 g/mol. Its IUPAC name is 5-(3-chloroprop-1-enyl)pyridine-2,3-diamine.
| Compound Name | 5-(3-chloroprop-1-enyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 169477134 |
| Molecular Formula | C8H10ClN3 |
| Molecular Weight | 183.64 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | 5-(3-chloroprop-1-enyl)pyridine-2,3-diamine |
| SMILES | Nc1cc(C=CCCl)cnc1N |
| InChI | InChI=1S/C8H10ClN3/c9-3-1-2-6-4-7(10)8(11)12-5-6/h1-2,4-5H,3,10H2,(H2,11,12) |
| InChIKey | NGHGBJJZOTUKAR-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.64 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|