C9H10N4 — CID 169463667
2-amino-5-(3-aminoprop-1-enyl)pyridine-3-carbonitrile (PubChem CID 169463667) has the molecular formula C9H10N4 and a molecular weight of 174.21 g/mol. Its IUPAC name is 2-amino-5-(3-aminoprop-1-enyl)pyridine-3-carbonitrile.
| Compound Name | 2-amino-5-(3-aminoprop-1-enyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 169463667 |
| Molecular Formula | C9H10N4 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 2-amino-5-(3-aminoprop-1-enyl)pyridine-3-carbonitrile |
| SMILES | N#Cc1cc(C=CCN)cnc1N |
| InChI | InChI=1S/C9H10N4/c10-3-1-2-7-4-8(5-11)9(12)13-6-7/h1-2,4,6H,3,10H2,(H2,12,13) |
| InChIKey | METPRYRQTHRFKF-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 88.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |