C10H9N3O2 — CID 170483669
4-(6-amino-5-cyano-3-pyridinyl)but-3-enoic acid (PubChem CID 170483669) has the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. Its IUPAC name is 4-(6-amino-5-cyano-3-pyridinyl)but-3-enoic acid.
| Compound Name | 4-(6-amino-5-cyano-3-pyridinyl)but-3-enoic acid |
|---|---|
| PubChem CID | 170483669 |
| Molecular Formula | C10H9N3O2 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 4-(6-amino-5-cyano-3-pyridinyl)but-3-enoic acid |
| SMILES | N#Cc1cc(C=CCC(=O)O)cnc1N |
| InChI | InChI=1S/C10H9N3O2/c11-5-8-4-7(6-13-10(8)12)2-1-3-9(14)15/h1-2,4,6H,3H2,(H2,12,13)(H,14,15) |
| InChIKey | BIQPNCMNFVWAIL-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 100.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |