C8H8Cl2N2 — CID 169463327
3-(5,6-dichloro-3-pyridinyl)prop-2-en-1-amine (PubChem CID 169463327) has the molecular formula C8H8Cl2N2 and a molecular weight of 203.07 g/mol. Its IUPAC name is 3-(5,6-dichloro-3-pyridinyl)prop-2-en-1-amine.
| Compound Name | 3-(5,6-dichloro-3-pyridinyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 169463327 |
| Molecular Formula | C8H8Cl2N2 |
| Molecular Weight | 203.07 g/mol |
| Exact Mass | 202.01 |
| IUPAC Name | 3-(5,6-dichloro-3-pyridinyl)prop-2-en-1-amine |
| SMILES | NCC=Cc1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C8H8Cl2N2/c9-7-4-6(2-1-3-11)5-12-8(7)10/h1-2,4-5H,3,11H2 |
| InChIKey | IZOFMIASRKIIMX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.07 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|