C6H3Cl2NO — CID 11535654
5,6-dichloropyridine-3-carbaldehyde (PubChem CID 11535654) has the molecular formula C6H3Cl2NO and a molecular weight of 176.00 g/mol. Its IUPAC name is 5,6-dichloropyridine-3-carbaldehyde.
| Compound Name | 5,6-dichloropyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 11535654 |
| Molecular Formula | C6H3Cl2NO |
| Molecular Weight | 176.00 g/mol |
| Exact Mass | 174.96 |
| IUPAC Name | 5,6-dichloropyridine-3-carbaldehyde |
| SMILES | O=Cc1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C6H3Cl2NO/c7-5-1-4(3-10)2-9-6(5)8/h1-3H |
| InChIKey | ROSCFXKNBQZLFC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.00 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|