C12H5Cl3FNO — CID 134637533
5-fluoro-6-(2,3,5-trichlorophenyl)pyridine-3-carbaldehyde (PubChem CID 134637533) has the molecular formula C12H5Cl3FNO and a molecular weight of 304.54 g/mol. Its IUPAC name is 5-fluoro-6-(2,3,5-trichlorophenyl)pyridine-3-carbaldehyde.
| Compound Name | 5-fluoro-6-(2,3,5-trichlorophenyl)pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 134637533 |
| Molecular Formula | C12H5Cl3FNO |
| Molecular Weight | 304.54 g/mol |
| Exact Mass | 302.94 |
| IUPAC Name | 5-fluoro-6-(2,3,5-trichlorophenyl)pyridine-3-carbaldehyde |
| SMILES | O=Cc1cnc(-c2cc(Cl)cc(Cl)c2Cl)c(F)c1 |
| InChI | InChI=1S/C12H5Cl3FNO/c13-7-2-8(11(15)9(14)3-7)12-10(16)1-6(5-18)4-17-12/h1-5H |
| InChIKey | NOXBCTFTGMVWKQ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.54 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|