C19H9Cl6NO2 — CID 134637233
2-[5,6-bis(2,3,5-trichlorophenyl)-3-pyridinyl]acetic acid (PubChem CID 134637233) has the molecular formula C19H9Cl6NO2 and a molecular weight of 496.00 g/mol. Its IUPAC name is 2-[5,6-bis(2,3,5-trichlorophenyl)-3-pyridinyl]acetic acid.
| Compound Name | 2-[5,6-bis(2,3,5-trichlorophenyl)-3-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 134637233 |
| Molecular Formula | C19H9Cl6NO2 |
| Molecular Weight | 496.00 g/mol |
| Exact Mass | 492.88 |
| IUPAC Name | 2-[5,6-bis(2,3,5-trichlorophenyl)-3-pyridinyl]acetic acid |
| SMILES | O=C(O)Cc1cnc(-c2cc(Cl)cc(Cl)c2Cl)c(-c2cc(Cl)cc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C19H9Cl6NO2/c20-9-3-11(17(24)14(22)5-9)12-1-8(2-16(27)28)7-26-19(12)13-4-10(21)6-15(23)18(13)25/h1,3-7H,2H2,(H,27,28) |
| InChIKey | AIUAIZLNWGFNKX-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.00 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|