C9H8Cl3N — CID 170498876
2,3-dichloro-5-(4-chlorobut-1-enyl)pyridine (PubChem CID 170498876) has the molecular formula C9H8Cl3N and a molecular weight of 236.53 g/mol. Its IUPAC name is 2,3-dichloro-5-(4-chlorobut-1-enyl)pyridine.
| Compound Name | 2,3-dichloro-5-(4-chlorobut-1-enyl)pyridine |
|---|---|
| PubChem CID | 170498876 |
| Molecular Formula | C9H8Cl3N |
| Molecular Weight | 236.53 g/mol |
| Exact Mass | 234.97 |
| IUPAC Name | 2,3-dichloro-5-(4-chlorobut-1-enyl)pyridine |
| SMILES | ClCCC=Cc1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H8Cl3N/c10-4-2-1-3-7-5-8(11)9(12)13-6-7/h1,3,5-6H,2,4H2 |
| InChIKey | YTPGVSIKJWPYJA-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.53 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|