About 5-(2-azidoethenyl)-2,3-dichloropyridine
5-(2-azidoethenyl)-2,3-dichloropyridine (PubChem CID 123496215) has the molecular formula C7H4Cl2N4
and a molecular weight of 215.04 g/mol. Its IUPAC name is 5-(2-azidoethenyl)-2,3-dichloropyridine.
Molecular Properties
| Compound Name | 5-(2-azidoethenyl)-2,3-dichloropyridine |
| PubChem CID | 123496215 |
| Molecular Formula | C7H4Cl2N4 |
| Molecular Weight | 215.04 g/mol |
| Exact Mass | 213.98 |
| IUPAC Name | 5-(2-azidoethenyl)-2,3-dichloropyridine |
| SMILES | [N-]=[N+]=NC=Cc1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C7H4Cl2N4/c8-6-3-5(1-2-12-13-10)4-11-7(6)9/h1-4H |
| InChIKey | FYGZMQNGHIHXRA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 61.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.04 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-azidoethenyl)-2,3-dichloropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-azidoethenyl)-2,3-dichloropyridine?
The IUPAC name of 5-(2-azidoethenyl)-2,3-dichloropyridine (CID 123496215) is 5-(2-azidoethenyl)-2,3-dichloropyridine.
What is the SMILES notation for 5-(2-azidoethenyl)-2,3-dichloropyridine?
The canonical SMILES for 5-(2-azidoethenyl)-2,3-dichloropyridine is [N-]=[N+]=NC=Cc1cnc(Cl)c(Cl)c1.
What is the InChIKey of 5-(2-azidoethenyl)-2,3-dichloropyridine?
The InChIKey is FYGZMQNGHIHXRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4Cl2N4/c8-6-3-5(1-2-12-13-10)4-11-7(6)9/h1-4H.
What are the key properties of 5-(2-azidoethenyl)-2,3-dichloropyridine?
5-(2-azidoethenyl)-2,3-dichloropyridine has a molecular weight of 215.04 g/mol, XLogP of 3.67, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-azidoethenyl)-2,3-dichloropyridine is sourced from PubChem (CID 123496215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).