C11H11N3O2 — CID 169480456
ethyl 3-(1H-pyrazolo[5,4-b]pyridin-5-yl)prop-2-enoate (PubChem CID 169480456) has the molecular formula C11H11N3O2 and a molecular weight of 217.23 g/mol. Its IUPAC name is ethyl 3-(1H-pyrazolo[5,4-b]pyridin-5-yl)prop-2-enoate.
| Compound Name | ethyl 3-(1H-pyrazolo[5,4-b]pyridin-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 169480456 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | ethyl 3-(1H-pyrazolo[5,4-b]pyridin-5-yl)prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1cnc2[nH]ncc2c1 |
| InChI | InChI=1S/C11H11N3O2/c1-2-16-10(15)4-3-8-5-9-7-13-14-11(9)12-6-8/h3-7H,2H2,1H3,(H,12,13,14) |
| InChIKey | BEPRNHKAVCDMNZ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|