C9H5ClF2O — CID 169484877
3-(3-chloro-2,4-difluorophenyl)prop-2-yn-1-ol (PubChem CID 169484877) has the molecular formula C9H5ClF2O and a molecular weight of 202.59 g/mol. Its IUPAC name is 3-(3-chloro-2,4-difluorophenyl)prop-2-yn-1-ol.
| Compound Name | 3-(3-chloro-2,4-difluorophenyl)prop-2-yn-1-ol |
|---|---|
| PubChem CID | 169484877 |
| Molecular Formula | C9H5ClF2O |
| Molecular Weight | 202.59 g/mol |
| Exact Mass | 202.00 |
| IUPAC Name | 3-(3-chloro-2,4-difluorophenyl)prop-2-yn-1-ol |
| SMILES | OCC#Cc1ccc(F)c(Cl)c1F |
| InChI | InChI=1S/C9H5ClF2O/c10-8-7(11)4-3-6(9(8)12)2-1-5-13/h3-4,13H,5H2 |
| InChIKey | MRPMOLNROXXYBY-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.59 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|