C12H16OSi — CID 169485183
3-(3-trimethylsilylphenyl)prop-2-yn-1-ol (PubChem CID 169485183) has the molecular formula C12H16OSi and a molecular weight of 204.34 g/mol. Its IUPAC name is 3-(3-trimethylsilylphenyl)prop-2-yn-1-ol.
| Compound Name | 3-(3-trimethylsilylphenyl)prop-2-yn-1-ol |
|---|---|
| PubChem CID | 169485183 |
| Molecular Formula | C12H16OSi |
| Molecular Weight | 204.34 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 3-(3-trimethylsilylphenyl)prop-2-yn-1-ol |
| SMILES | C[Si](C)(C)c1cccc(C#CCO)c1 |
| InChI | InChI=1S/C12H16OSi/c1-14(2,3)12-8-4-6-11(10-12)7-5-9-13/h4,6,8,10,13H,9H2,1-3H3 |
| InChIKey | HVEQUSXADYFQRY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.34 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|