C11H11NO2S — CID 169487202
ethyl 6-(3-sulfanylprop-1-ynyl)pyridine-2-carboxylate (PubChem CID 169487202) has the molecular formula C11H11NO2S and a molecular weight of 221.28 g/mol. Its IUPAC name is ethyl 6-(3-sulfanylprop-1-ynyl)pyridine-2-carboxylate.
| Compound Name | ethyl 6-(3-sulfanylprop-1-ynyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 169487202 |
| Molecular Formula | C11H11NO2S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | ethyl 6-(3-sulfanylprop-1-ynyl)pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cccc(C#CCS)n1 |
| InChI | InChI=1S/C11H11NO2S/c1-2-14-11(13)10-7-3-5-9(12-10)6-4-8-15/h3,5,7,15H,2,8H2,1H3 |
| InChIKey | FOTHHHZDQAKROD-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 39.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|