C24H29N3O3S — CID 169487812
N-cyclohexyl-4-[(6-ethoxy-2-methylquinolin-4-yl)amino]benzenesulfonamide (PubChem CID 169487812) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is N-cyclohexyl-4-[(6-ethoxy-2-methylquinolin-4-yl)amino]benzenesulfonamide.
| Compound Name | N-cyclohexyl-4-[(6-ethoxy-2-methylquinolin-4-yl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 169487812 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | N-cyclohexyl-4-[(6-ethoxy-2-methylquinolin-4-yl)amino]benzenesulfonamide |
| SMILES | CCOc1ccc2nc(C)cc(Nc3ccc(S(=O)(=O)NC4CCCCC4)cc3)c2c1 |
| InChI | InChI=1S/C24H29N3O3S/c1-3-30-20-11-14-23-22(16-20)24(15-17(2)25-23)26-18-9-12-21(13-10-18)31(28,29)27-19-7-5-4-6-8-19/h9-16,19,27H,3-8H2,1-2H3,(H,25,26) |
| InChIKey | XYDYWSQUDQTHRK-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |