C33H26Br2O4 — CID 169487983
(E)-3-(2-bromophenyl)-1-[3-[3-[3-[(E)-3-(2-bromophenyl)prop-2-enoyl]phenoxy]propoxy]phenyl]prop-2-en-1-one (PubChem CID 169487983) has the molecular formula C33H26Br2O4 and a molecular weight of 646.38 g/mol. Its IUPAC name is (E)-3-(2-bromophenyl)-1-[3-[3-[3-[(E)-3-(2-bromophenyl)prop-2-enoyl]phenoxy]propoxy]phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(2-bromophenyl)-1-[3-[3-[3-[(E)-3-(2-bromophenyl)prop-2-enoyl]phenoxy]propoxy]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 169487983 |
| Molecular Formula | C33H26Br2O4 |
| Molecular Weight | 646.38 g/mol |
| Exact Mass | 644.02 |
| IUPAC Name | (E)-3-(2-bromophenyl)-1-[3-[3-[3-[(E)-3-(2-bromophenyl)prop-2-enoyl]phenoxy]propoxy]phenyl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1Br)c1cccc(OCCCOc2cccc(C(=O)/C=C/c3ccccc3Br)c2)c1 |
| InChI | InChI=1S/C33H26Br2O4/c34-30-14-3-1-8-24(30)16-18-32(36)26-10-5-12-28(22-26)38-20-7-21-39-29-13-6-11-27(23-29)33(37)19-17-25-9-2-4-15-31(25)35/h1-6,8-19,22-23H,7,20-21H2/b18-16+,19-17+ |
| InChIKey | WARMWXHCQPJQKH-YWNVXTCZSA-N |
| XLogP | 8.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.38 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|