C12H13BrF2N2O — CID 169488552
2-(5-bromo-3-pyridinyl)-1-(3,3-difluoropiperidin-1-yl)ethanone (PubChem CID 169488552) has the molecular formula C12H13BrF2N2O and a molecular weight of 319.15 g/mol. Its IUPAC name is 2-(5-bromo-3-pyridinyl)-1-(3,3-difluoropiperidin-1-yl)ethanone.
| Compound Name | 2-(5-bromo-3-pyridinyl)-1-(3,3-difluoropiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 169488552 |
| Molecular Formula | C12H13BrF2N2O |
| Molecular Weight | 319.15 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 2-(5-bromo-3-pyridinyl)-1-(3,3-difluoropiperidin-1-yl)ethanone |
| SMILES | O=C(Cc1cncc(Br)c1)N1CCCC(F)(F)C1 |
| InChI | InChI=1S/C12H13BrF2N2O/c13-10-4-9(6-16-7-10)5-11(18)17-3-1-2-12(14,15)8-17/h4,6-7H,1-3,5,8H2 |
| InChIKey | OGOZLDOXMNNDPN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.15 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |