C21H22FN3O3 — CID 169489844
7-(3-fluorophenyl)-5-[4-(2-methoxyethoxy)phenyl]-2,3,4a,7a-tetrahydro-1H-pyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 169489844) has the molecular formula C21H22FN3O3 and a molecular weight of 383.42 g/mol. Its IUPAC name is 7-(3-fluorophenyl)-5-[4-(2-methoxyethoxy)phenyl]-2,3,4a,7a-tetrahydro-1H-pyrrolo[2,3-d]pyrimidin-4-one.
| Compound Name | 7-(3-fluorophenyl)-5-[4-(2-methoxyethoxy)phenyl]-2,3,4a,7a-tetrahydro-1H-pyrrolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 169489844 |
| Molecular Formula | C21H22FN3O3 |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 7-(3-fluorophenyl)-5-[4-(2-methoxyethoxy)phenyl]-2,3,4a,7a-tetrahydro-1H-pyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | COCCOc1ccc(C2=CN(c3cccc(F)c3)C3NCNC(=O)C23)cc1 |
| InChI | InChI=1S/C21H22FN3O3/c1-27-9-10-28-17-7-5-14(6-8-17)18-12-25(16-4-2-3-15(22)11-16)20-19(18)21(26)24-13-23-20/h2-8,11-12,19-20,23H,9-10,13H2,1H3,(H,24,26) |
| InChIKey | XFGULZDLZSOIFQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|