C24H37N5O5 — CID 169491132
[(3Z)-cyclooct-3-en-1-yl] N-[2-[2-[2-[[6-(2-propan-2-ylidenehydrazinyl)pyridine-3-carbonyl]amino]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 169491132) has the molecular formula C24H37N5O5 and a molecular weight of 475.59 g/mol. Its IUPAC name is [(3Z)-cyclooct-3-en-1-yl] N-[2-[2-[2-[[6-(2-propan-2-ylidenehydrazinyl)pyridine-3-carbonyl]amino]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | [(3Z)-cyclooct-3-en-1-yl] N-[2-[2-[2-[[6-(2-propan-2-ylidenehydrazinyl)pyridine-3-carbonyl]amino]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 169491132 |
| Molecular Formula | C24H37N5O5 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.28 |
| IUPAC Name | [(3Z)-cyclooct-3-en-1-yl] N-[2-[2-[2-[[6-(2-propan-2-ylidenehydrazinyl)pyridine-3-carbonyl]amino]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CC(C)=NNc1ccc(C(=O)NCCOCCOCCNC(=O)OC2C/C=C\CCCC2)cn1 |
| InChI | InChI=1S/C24H37N5O5/c1-19(2)28-29-22-11-10-20(18-27-22)23(30)25-12-14-32-16-17-33-15-13-26-24(31)34-21-8-6-4-3-5-7-9-21/h4,6,10-11,18,21H,3,5,7-9,12-17H2,1-2H3,(H,25,30)(H,26,31)(H,27,29)/b6-4- |
| InChIKey | ZHBFBQSGYCJRKX-XQRVVYSFSA-N |
| XLogP | 3.27 |
| TPSA | 123.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|