C18H18N2O5S — CID 169492106
[4-[[5-[(4-methoxyphenyl)methyl]-1H-imidazol-4-yl]methyl]phenyl] hydrogen sulfate (PubChem CID 169492106) has the molecular formula C18H18N2O5S and a molecular weight of 374.42 g/mol. Its IUPAC name is [4-[[5-[(4-methoxyphenyl)methyl]-1H-imidazol-4-yl]methyl]phenyl] hydrogen sulfate.
| Compound Name | [4-[[5-[(4-methoxyphenyl)methyl]-1H-imidazol-4-yl]methyl]phenyl] hydrogen sulfate |
|---|---|
| PubChem CID | 169492106 |
| Molecular Formula | C18H18N2O5S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | [4-[[5-[(4-methoxyphenyl)methyl]-1H-imidazol-4-yl]methyl]phenyl] hydrogen sulfate |
| SMILES | COc1ccc(Cc2[nH]cnc2Cc2ccc(OS(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C18H18N2O5S/c1-24-15-6-2-13(3-7-15)10-17-18(20-12-19-17)11-14-4-8-16(9-5-14)25-26(21,22)23/h2-9,12H,10-11H2,1H3,(H,19,20)(H,21,22,23) |
| InChIKey | VGMAJATUYIBHCK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 101.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|