C23H23N7O3 — CID 169492289
2-amino-8-[[(3S,6S)-13-oxa-4,20-diazatetracyclo[12.2.2.23,6.18,12]henicosa-1(16),8(19),9,11,14,17-hexaen-11-yl]oxy]-1,7-dihydropurin-6-one (PubChem CID 169492289) has the molecular formula C23H23N7O3 and a molecular weight of 445.48 g/mol. Its IUPAC name is 2-amino-8-[[(3S,6S)-13-oxa-4,20-diazatetracyclo[12.2.2.23,6.18,12]henicosa-1(16),8(19),9,11,14,17-hexaen-11-yl]oxy]-1,7-dihydropurin-6-one.
| Compound Name | 2-amino-8-[[(3S,6S)-13-oxa-4,20-diazatetracyclo[12.2.2.23,6.18,12]henicosa-1(16),8(19),9,11,14,17-hexaen-11-yl]oxy]-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 169492289 |
| Molecular Formula | C23H23N7O3 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 2-amino-8-[[(3S,6S)-13-oxa-4,20-diazatetracyclo[12.2.2.23,6.18,12]henicosa-1(16),8(19),9,11,14,17-hexaen-11-yl]oxy]-1,7-dihydropurin-6-one |
| SMILES | Nc1nc2nc(Oc3ccc4cc3Oc3ccc(cc3)C[C@H]3CN[C@H](CN3)C4)[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C23H23N7O3/c24-22-28-20-19(21(31)30-22)27-23(29-20)33-17-6-3-13-8-15-11-25-14(10-26-15)7-12-1-4-16(5-2-12)32-18(17)9-13/h1-6,9,14-15,25-26H,7-8,10-11H2,(H4,24,27,28,29,30,31)/t14-,15-/m0/s1 |
| InChIKey | IBOGMHPJDKMKDZ-GJZGRUSLSA-N |
| XLogP | 1.84 |
| TPSA | 142.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |