C17H21N3O2S2 — CID 16949247
S-[2-[4-(4,6-dimethyl-1,3-benzothiazol-2-yl)piperazin-1-yl]-2-oxoethyl] ethanethioate (PubChem CID 16949247) has the molecular formula C17H21N3O2S2 and a molecular weight of 363.51 g/mol. Its IUPAC name is S-[2-[4-(4,6-dimethyl-1,3-benzothiazol-2-yl)piperazin-1-yl]-2-oxoethyl] ethanethioate.
| Compound Name | S-[2-[4-(4,6-dimethyl-1,3-benzothiazol-2-yl)piperazin-1-yl]-2-oxoethyl] ethanethioate |
|---|---|
| PubChem CID | 16949247 |
| Molecular Formula | C17H21N3O2S2 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | S-[2-[4-(4,6-dimethyl-1,3-benzothiazol-2-yl)piperazin-1-yl]-2-oxoethyl] ethanethioate |
| SMILES | CC(=O)SCC(=O)N1CCN(c2nc3c(C)cc(C)cc3s2)CC1 |
| InChI | InChI=1S/C17H21N3O2S2/c1-11-8-12(2)16-14(9-11)24-17(18-16)20-6-4-19(5-7-20)15(22)10-23-13(3)21/h8-9H,4-7,10H2,1-3H3 |
| InChIKey | QBJGIYKZMUTAPC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|