C16H19N3O4S3 — CID 16949265
S-[2-[4-(4-methylsulfonyl-1,3-benzothiazol-2-yl)piperazin-1-yl]-2-oxoethyl] ethanethioate (PubChem CID 16949265) has the molecular formula C16H19N3O4S3 and a molecular weight of 413.55 g/mol. Its IUPAC name is S-[2-[4-(4-methylsulfonyl-1,3-benzothiazol-2-yl)piperazin-1-yl]-2-oxoethyl] ethanethioate.
| Compound Name | S-[2-[4-(4-methylsulfonyl-1,3-benzothiazol-2-yl)piperazin-1-yl]-2-oxoethyl] ethanethioate |
|---|---|
| PubChem CID | 16949265 |
| Molecular Formula | C16H19N3O4S3 |
| Molecular Weight | 413.55 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | S-[2-[4-(4-methylsulfonyl-1,3-benzothiazol-2-yl)piperazin-1-yl]-2-oxoethyl] ethanethioate |
| SMILES | CC(=O)SCC(=O)N1CCN(c2nc3c(S(C)(=O)=O)cccc3s2)CC1 |
| InChI | InChI=1S/C16H19N3O4S3/c1-11(20)24-10-14(21)18-6-8-19(9-7-18)16-17-15-12(25-16)4-3-5-13(15)26(2,22)23/h3-5H,6-10H2,1-2H3 |
| InChIKey | CDNMIEBXELMKIW-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.55 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|