C13H16N2O3S2 — CID 154883454
1-(4-methylsulfonyl-1,3-benzothiazol-2-yl)piperidin-3-ol (PubChem CID 154883454) has the molecular formula C13H16N2O3S2 and a molecular weight of 312.42 g/mol. Its IUPAC name is 1-(4-methylsulfonyl-1,3-benzothiazol-2-yl)piperidin-3-ol.
| Compound Name | 1-(4-methylsulfonyl-1,3-benzothiazol-2-yl)piperidin-3-ol |
|---|---|
| PubChem CID | 154883454 |
| Molecular Formula | C13H16N2O3S2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 1-(4-methylsulfonyl-1,3-benzothiazol-2-yl)piperidin-3-ol |
| SMILES | CS(=O)(=O)c1cccc2sc(N3CCCC(O)C3)nc12 |
| InChI | InChI=1S/C13H16N2O3S2/c1-20(17,18)11-6-2-5-10-12(11)14-13(19-10)15-7-3-4-9(16)8-15/h2,5-6,9,16H,3-4,7-8H2,1H3 |
| InChIKey | BODQEBJJPBOROG-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |