C14H18N2O2S — CID 171324124
1-(4-ethoxy-1,3-benzothiazol-2-yl)piperidin-3-ol (PubChem CID 171324124) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is 1-(4-ethoxy-1,3-benzothiazol-2-yl)piperidin-3-ol.
| Compound Name | 1-(4-ethoxy-1,3-benzothiazol-2-yl)piperidin-3-ol |
|---|---|
| PubChem CID | 171324124 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 1-(4-ethoxy-1,3-benzothiazol-2-yl)piperidin-3-ol |
| SMILES | CCOc1cccc2sc(N3CCCC(O)C3)nc12 |
| InChI | InChI=1S/C14H18N2O2S/c1-2-18-11-6-3-7-12-13(11)15-14(19-12)16-8-4-5-10(17)9-16/h3,6-7,10,17H,2,4-5,8-9H2,1H3 |
| InChIKey | YGLIKBZYEWXSTE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |